guest ::
| Home > Publications database > Publisher Correction: Non-functional ubiquitin C-terminal hydrolase L1 drives podocyte injury through impairing proteasomes in autoimmune glomerulonephritis > print |
| Home > Publications database > Publisher Correction: Non-functional ubiquitin C-terminal hydrolase L1 drives podocyte injury through impairing proteasomes in autoimmune glomerulonephritis > print |
| 001 | 634676 | ||
| 005 | 20250929153744.0 | ||
| 024 | 7 | _ | |a 10.1038/s41467-023-38206-0 |2 doi |
| 024 | 7 | _ | |a 10.3204/PUBDB-2025-02590 |2 datacite_doi |
| 024 | 7 | _ | |a openalex:W4367319174 |2 openalex |
| 037 | _ | _ | |a PUBDB-2025-02590 |
| 041 | _ | _ | |a English |
| 082 | _ | _ | |a 500 |
| 100 | 1 | _ | |a Reichelt, Julia |b 0 |
| 245 | _ | _ | |a Publisher Correction: Non-functional ubiquitin C-terminal hydrolase L1 drives podocyte injury through impairing proteasomes in autoimmune glomerulonephritis |
| 260 | _ | _ | |a [London] |c 2023 |b Springer Nature |
| 336 | 7 | _ | |a article |2 DRIVER |
| 336 | 7 | _ | |a Output Types/Journal article |2 DataCite |
| 336 | 7 | _ | |a Journal Article |b journal |m journal |0 PUB:(DE-HGF)16 |s 1755507363_3983131 |2 PUB:(DE-HGF) |
| 336 | 7 | _ | |a ARTICLE |2 BibTeX |
| 336 | 7 | _ | |a JOURNAL_ARTICLE |2 ORCID |
| 336 | 7 | _ | |a Journal Article |0 0 |2 EndNote |
| 500 | _ | _ | |a cc-by, The authors would like to thank Antonio Virgillio Failla from the UMIF,UKE and Roland Thuenauer from the ALFM, CSSB, DESY for technicalassistance in super resolution microscopy. |
| 520 | _ | _ | |a The original version of this Article contained errors in Figures 3b, 7d, 7e and 8b, where boxes were used instead of arrows to indicate the specific signals for the blots, and in Figure 8c, the format of the “betas“ was incorrect. This has been corrected in both the PDF and HTML versions of the Article. |
| 536 | _ | _ | |a 633 - Life Sciences – Building Blocks of Life: Structure and Function (POF4-633) |0 G:(DE-HGF)POF4-633 |c POF4-633 |f POF IV |x 0 |
| 588 | _ | _ | |a Dataset connected to CrossRef, Journals: bib-pubdb1.desy.de |
| 693 | _ | _ | |0 EXP:(DE-MLZ)NOSPEC-20140101 |5 EXP:(DE-MLZ)NOSPEC-20140101 |e No specific instrument |x 0 |
| 700 | 1 | _ | |a Sachs, Wiebke |b 1 |
| 700 | 1 | _ | |a Frömbling, Sarah |b 2 |
| 700 | 1 | _ | |a Fehlert, Julia |b 3 |
| 700 | 1 | _ | |a Studencka-Turski, Maja |b 4 |
| 700 | 1 | _ | |a Betz, Anna |b 5 |
| 700 | 1 | _ | |a Loreth, Desiree |0 0000-0003-0827-149X |b 6 |
| 700 | 1 | _ | |a Blume, Lukas |0 0000-0003-1889-0470 |b 7 |
| 700 | 1 | _ | |a Witt, Susanne |0 P:(DE-H253)PIP1085705 |b 8 |
| 700 | 1 | _ | |a Pohl, Sandra |b 9 |
| 700 | 1 | _ | |a Brand, Johannes |b 10 |
| 700 | 1 | _ | |a Czesla, Maire |b 11 |
| 700 | 1 | _ | |a Knop, Jan |0 P:(DE-H253)PIP1032213 |b 12 |
| 700 | 1 | _ | |a Florea, Bogdan I. |b 13 |
| 700 | 1 | _ | |a Zielinski, Stephanie |b 14 |
| 700 | 1 | _ | |a Sachs, Marlies |b 15 |
| 700 | 1 | _ | |a Hoxha, Elion |b 16 |
| 700 | 1 | _ | |a Hermans-Borgmeyer, Irm |b 17 |
| 700 | 1 | _ | |a Zahner, Gunther |b 18 |
| 700 | 1 | _ | |a Wiech, Thorsten |0 0000-0003-4053-1474 |b 19 |
| 700 | 1 | _ | |a Krüger, Elke |0 0000-0002-2551-242X |b 20 |
| 700 | 1 | _ | |a Meyer-Schwesinger, Catherine |0 P:(DE-HGF)0 |b 21 |e Corresponding author |
| 773 | _ | _ | |a 10.1038/s41467-023-38206-0 |g Vol. 14, no. 1, p. 2453 |0 PERI:(DE-600)2553671-0 |n 1 |p 2453 |t Nature Communications |v 14 |y 2023 |x 2041-1723 |
| 787 | 0 | _ | |a Reichelt, Julia et.al. |d London : Nature Publishing Group UK, 2023 |i IsParent |0 PUBDB-2023-07626 |r |t Non-functional ubiquitin C-terminal hydrolase L1 drives podocyte injury through impairing proteasomes in autoimmune glomerulonephritis |
| 856 | 4 | _ | |y OpenAccess |u https://bib-pubdb1.desy.de/record/634676/files/s41467-023-38206-0-1.pdf |
| 856 | 4 | _ | |y OpenAccess |x pdfa |u https://bib-pubdb1.desy.de/record/634676/files/s41467-023-38206-0-1.pdf?subformat=pdfa |
| 909 | C | O | |o oai:bib-pubdb1.desy.de:634676 |p openaire |p open_access |p VDB |p driver |p dnbdelivery |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 8 |6 P:(DE-H253)PIP1085705 |
| 910 | 1 | _ | |a External Institute |0 I:(DE-HGF)0 |k Extern |b 8 |6 P:(DE-H253)PIP1085705 |
| 910 | 1 | _ | |a Deutsches Elektronen-Synchrotron |0 I:(DE-588b)2008985-5 |k DESY |b 8 |6 P:(DE-H253)PIP1085705 |
| 910 | 1 | _ | |a European Molecular Biology Laboratory |0 I:(DE-588b)235011-7 |k EMBL |b 12 |6 P:(DE-H253)PIP1032213 |
| 910 | 1 | _ | |a External Institute |0 I:(DE-HGF)0 |k Extern |b 12 |6 P:(DE-H253)PIP1032213 |
| 913 | 1 | _ | |a DE-HGF |b Forschungsbereich Materie |l Von Materie zu Materialien und Leben |1 G:(DE-HGF)POF4-630 |0 G:(DE-HGF)POF4-633 |3 G:(DE-HGF)POF4 |2 G:(DE-HGF)POF4-600 |4 G:(DE-HGF)POF |v Life Sciences – Building Blocks of Life: Structure and Function |x 0 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0200 |2 StatID |b SCOPUS |d 2025-01-02 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0160 |2 StatID |b Essential Science Indicators |d 2025-01-02 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)1050 |2 StatID |b BIOSIS Previews |d 2025-01-02 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)1190 |2 StatID |b Biological Abstracts |d 2025-01-02 |
| 915 | _ | _ | |a OpenAccess |0 StatID:(DE-HGF)0510 |2 StatID |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)1040 |2 StatID |b Zoological Record |d 2025-01-02 |
| 915 | _ | _ | |a IF >= 15 |0 StatID:(DE-HGF)9915 |2 StatID |b NAT COMMUN : 2022 |d 2025-01-02 |
| 915 | _ | _ | |a JCR |0 StatID:(DE-HGF)0100 |2 StatID |b NAT COMMUN : 2022 |d 2025-01-02 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0501 |2 StatID |b DOAJ Seal |d 2024-01-30T07:48:07Z |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0500 |2 StatID |b DOAJ |d 2024-01-30T07:48:07Z |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)1030 |2 StatID |b Current Contents - Life Sciences |d 2025-01-02 |
| 915 | _ | _ | |a Fees |0 StatID:(DE-HGF)0700 |2 StatID |d 2025-01-02 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0150 |2 StatID |b Web of Science Core Collection |d 2025-01-02 |
| 915 | _ | _ | |a Creative Commons Attribution CC BY 4.0 |0 LIC:(DE-HGF)CCBY4 |2 HGFVOC |
| 915 | _ | _ | |a WoS |0 StatID:(DE-HGF)0113 |2 StatID |b Science Citation Index Expanded |d 2025-01-02 |
| 915 | _ | _ | |a Peer Review |0 StatID:(DE-HGF)0030 |2 StatID |b DOAJ : Peer review |d 2024-01-30T07:48:07Z |
| 915 | _ | _ | |a Article Processing Charges |0 StatID:(DE-HGF)0561 |2 StatID |d 2025-01-02 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)1060 |2 StatID |b Current Contents - Agriculture, Biology and Environmental Sciences |d 2025-01-02 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0300 |2 StatID |b Medline |d 2025-01-02 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)1150 |2 StatID |b Current Contents - Physical, Chemical and Earth Sciences |d 2025-01-02 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0199 |2 StatID |b Clarivate Analytics Master Journal List |d 2025-01-02 |
| 920 | 1 | _ | |0 I:(DE-H253)FS-CS-20210408 |k FS-CS |l Strukturelle Mikrobiologie CSSB |x 0 |
| 920 | 1 | _ | |0 I:(DE-H253)CSSB-CF-PP-20210530 |k CSSB-CF-PP |l CSSB - Core Facility - Protein Production |x 1 |
| 980 | _ | _ | |a journal |
| 980 | _ | _ | |a VDB |
| 980 | _ | _ | |a UNRESTRICTED |
| 980 | _ | _ | |a I:(DE-H253)FS-CS-20210408 |
| 980 | _ | _ | |a I:(DE-H253)CSSB-CF-PP-20210530 |
| 980 | 1 | _ | |a FullTexts |
| Library | Collection | CLSMajor | CLSMinor | Language | Author |
|---|