guest ::
| Home > Publications database > Structure-Based Identification and Functional Characterization of a Lipocalin in the Malaria Parasite Plasmodium falciparum > print |
| Home > Publications database > Structure-Based Identification and Functional Characterization of a Lipocalin in the Malaria Parasite Plasmodium falciparum > print |
| 001 | 441413 | ||
| 005 | 20250729150459.0 | ||
| 024 | 7 | _ | |a 10.1016/j.celrep.2020.107817 |2 doi |
| 024 | 7 | _ | |a 2211-1247 |2 ISSN |
| 024 | 7 | _ | |a 2639-1856 |2 ISSN |
| 024 | 7 | _ | |a 10.3204/PUBDB-2020-02482 |2 datacite_doi |
| 024 | 7 | _ | |a altmetric:84569956 |2 altmetric |
| 024 | 7 | _ | |a pmid:32579913 |2 pmid |
| 024 | 7 | _ | |a WOS:000543381400031 |2 WOS |
| 024 | 7 | _ | |a openalex:W3037225602 |2 openalex |
| 037 | _ | _ | |a PUBDB-2020-02482 |
| 041 | _ | _ | |a English |
| 082 | _ | _ | |a 610 |
| 100 | 1 | _ | |a Burda, Paul-Christian |0 P:(DE-H253)PIP1085756 |b 0 |
| 245 | _ | _ | |a Structure-Based Identification and Functional Characterization of a Lipocalin in the Malaria Parasite Plasmodium falciparum |
| 260 | _ | _ | |a [New York, NY] |c 2020 |b Elsevier |
| 336 | 7 | _ | |a article |2 DRIVER |
| 336 | 7 | _ | |a Output Types/Journal article |2 DataCite |
| 336 | 7 | _ | |a Journal Article |b journal |m journal |0 PUB:(DE-HGF)16 |s 1751874723_3158369 |2 PUB:(DE-HGF) |
| 336 | 7 | _ | |a ARTICLE |2 BibTeX |
| 336 | 7 | _ | |a JOURNAL_ARTICLE |2 ORCID |
| 336 | 7 | _ | |a Journal Article |0 0 |2 EndNote |
| 500 | _ | _ | |a PIF-2018-87 |
| 520 | _ | _ | |a Proteins of the lipocalin family are known to bind small hydrophobic ligands and are involved in various physiological processes ranging from lipid transport to oxidative stress responses. The genome of the malaria parasite Plasmodium falciparum contains a single protein PF3D7_0925900 with a lipocalin signature. Using crystallography and small-angle X-ray scattering, we show that the protein has a tetrameric structure of typical lipocalin monomers; hence we name it P. falciparum lipocalin (PfLCN). We show that PfLCN is expressed in the intraerythrocytic stages of the parasite and localizes to the parasitophorous and food vacuoles. Conditional knockdown of PfLCN impairs parasite development, which can be rescued by treatment with the radical scavenger Trolox or by temporal inhibition of hemoglobin digestion. This suggests a key function of PfLCN in counteracting oxidative stress-induced cell damage during multiplication of parasites within erythrocytes. |
| 536 | _ | _ | |a 6G3 - PETRA III (POF3-622) |0 G:(DE-HGF)POF3-6G3 |c POF3-622 |f POF III |x 0 |
| 588 | _ | _ | |a Dataset connected to CrossRef |
| 693 | _ | _ | |a PETRA III |f PETRA Beamline P13 |1 EXP:(DE-H253)PETRAIII-20150101 |0 EXP:(DE-H253)P-P13-20150101 |6 EXP:(DE-H253)P-P13-20150101 |x 0 |
| 693 | _ | _ | |a PETRA III |f PETRA Beamline P12 |1 EXP:(DE-H253)PETRAIII-20150101 |0 EXP:(DE-H253)P-P12-20150101 |6 EXP:(DE-H253)P-P12-20150101 |x 1 |
| 700 | 1 | _ | |a Crosskey, Thomas |0 P:(DE-H253)PIP1080461 |b 1 |
| 700 | 1 | _ | |a Lauk, Katharina |0 P:(DE-H253)PIP1086561 |b 2 |
| 700 | 1 | _ | |a Zurborg, Aimo |0 P:(DE-H253)PIP1090332 |b 3 |
| 700 | 1 | _ | |a Söhnchen, Christoph |b 4 |
| 700 | 1 | _ | |a Liffner, Benjamin |0 P:(DE-H253)PIP1084754 |b 5 |
| 700 | 1 | _ | |a Wilcke, Louisa |0 P:(DE-H253)PIP1088064 |b 6 |
| 700 | 1 | _ | |a Pietsch, Emma |0 P:(DE-H253)PIP1090898 |b 7 |
| 700 | 1 | _ | |a Strauss, Jan |0 P:(DE-H253)PIP1081588 |b 8 |
| 700 | 1 | _ | |a Jeffries, Cy M. |0 P:(DE-H253)PIP1018937 |b 9 |
| 700 | 1 | _ | |a Svergun, Dmitri I. |0 P:(DE-H253)PIP1001422 |b 10 |
| 700 | 1 | _ | |a Wilson, Danny W. |b 11 |
| 700 | 1 | _ | |a Wilmanns, Matthias |0 P:(DE-H253)PIP1001283 |b 12 |
| 700 | 1 | _ | |a Gilberger, Tim-Wolf |0 P:(DE-H253)PIP1023784 |b 13 |e Corresponding author |
| 773 | _ | _ | |a 10.1016/j.celrep.2020.107817 |g Vol. 31, no. 12, p. 107817 - |0 PERI:(DE-600)2649101-1 |n 12 |p 107817 - |t Cell reports |v 31 |y 2020 |x 2211-1247 |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/441413/files/1-s2.0-S2211124720307981-main.pdf |y OpenAccess |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/441413/files/1-s2.0-S2211124720307981-main.gif?subformat=icon |x icon |y OpenAccess |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/441413/files/1-s2.0-S2211124720307981-main.jpg?subformat=icon-1440 |x icon-1440 |y OpenAccess |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/441413/files/1-s2.0-S2211124720307981-main.jpg?subformat=icon-180 |x icon-180 |y OpenAccess |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/441413/files/1-s2.0-S2211124720307981-main.jpg?subformat=icon-640 |x icon-640 |y OpenAccess |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/441413/files/1-s2.0-S2211124720307981-main.pdf?subformat=pdfa |x pdfa |y OpenAccess |
| 909 | C | O | |o oai:bib-pubdb1.desy.de:441413 |p openaire |p open_access |p VDB |p driver |p dnbdelivery |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 0 |6 P:(DE-H253)PIP1085756 |
| 910 | 1 | _ | |a European Molecular Biology Laboratory |0 I:(DE-588b)235011-7 |k EMBL |b 1 |6 P:(DE-H253)PIP1080461 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 2 |6 P:(DE-H253)PIP1086561 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 3 |6 P:(DE-H253)PIP1090332 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 5 |6 P:(DE-H253)PIP1084754 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 6 |6 P:(DE-H253)PIP1088064 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 7 |6 P:(DE-H253)PIP1090898 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 8 |6 P:(DE-H253)PIP1081588 |
| 910 | 1 | _ | |a European Molecular Biology Laboratory |0 I:(DE-588b)235011-7 |k EMBL |b 8 |6 P:(DE-H253)PIP1081588 |
| 910 | 1 | _ | |a European Molecular Biology Laboratory |0 I:(DE-588b)235011-7 |k EMBL |b 9 |6 P:(DE-H253)PIP1018937 |
| 910 | 1 | _ | |a External Institute |0 I:(DE-HGF)0 |k Extern |b 9 |6 P:(DE-H253)PIP1018937 |
| 910 | 1 | _ | |a European Molecular Biology Laboratory |0 I:(DE-588b)235011-7 |k EMBL |b 10 |6 P:(DE-H253)PIP1001422 |
| 910 | 1 | _ | |a European Molecular Biology Laboratory |0 I:(DE-588b)235011-7 |k EMBL |b 12 |6 P:(DE-H253)PIP1001283 |
| 910 | 1 | _ | |a External Institute |0 I:(DE-HGF)0 |k Extern |b 12 |6 P:(DE-H253)PIP1001283 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 13 |6 P:(DE-H253)PIP1023784 |
| 913 | 1 | _ | |a DE-HGF |b Forschungsbereich Materie |l Von Materie zu Materialien und Leben |1 G:(DE-HGF)POF3-620 |0 G:(DE-HGF)POF3-622 |3 G:(DE-HGF)POF3 |2 G:(DE-HGF)POF3-600 |4 G:(DE-HGF)POF |v Facility topic: Research on Matter with Brilliant Light Sources |9 G:(DE-HGF)POF3-6G3 |x 0 |
| 914 | 1 | _ | |y 2020 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0200 |2 StatID |b SCOPUS |d 2020-01-17 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0160 |2 StatID |b Essential Science Indicators |d 2020-01-17 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)1050 |2 StatID |b BIOSIS Previews |d 2020-01-17 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)1190 |2 StatID |b Biological Abstracts |d 2020-01-17 |
| 915 | _ | _ | |a Creative Commons Attribution-NonCommercial-NoDerivs CC BY-NC-ND 4.0 |0 LIC:(DE-HGF)CCBYNCND4 |2 HGFVOC |
| 915 | _ | _ | |a JCR |0 StatID:(DE-HGF)0100 |2 StatID |b CELL REP : 2018 |d 2020-01-17 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0501 |2 StatID |b DOAJ Seal |d 2020-01-17 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0500 |2 StatID |b DOAJ |d 2020-01-17 |
| 915 | _ | _ | |a WoS |0 StatID:(DE-HGF)0111 |2 StatID |b Science Citation Index Expanded |d 2020-01-17 |
| 915 | _ | _ | |a Fees |0 StatID:(DE-HGF)0700 |2 StatID |d 2020-01-17 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0150 |2 StatID |b Web of Science Core Collection |d 2020-01-17 |
| 915 | _ | _ | |a OpenAccess |0 StatID:(DE-HGF)0510 |2 StatID |
| 915 | _ | _ | |a Peer Review |0 StatID:(DE-HGF)0030 |2 StatID |b DOAJ : Blind peer review |d 2020-01-17 |
| 915 | _ | _ | |a Article Processing Charges |0 StatID:(DE-HGF)0561 |2 StatID |f 2020-01-17 |
| 915 | _ | _ | |a IF >= 5 |0 StatID:(DE-HGF)9905 |2 StatID |b CELL REP : 2018 |d 2020-01-17 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0310 |2 StatID |b NCBI Molecular Biology Database |d 2020-01-17 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0300 |2 StatID |b Medline |d 2020-01-17 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0199 |2 StatID |b Clarivate Analytics Master Journal List |d 2020-01-17 |
| 920 | 1 | _ | |0 I:(DE-H253)CSSB-BNI-20141216 |k CSSB-BNI |l CSSB-BNI |x 0 |
| 920 | 1 | _ | |0 I:(DE-H253)EMBL-20120731 |k EMBL |l EMBL |x 1 |
| 920 | 1 | _ | |0 I:(DE-H253)FS-CSSB-GS-20140815 |k FS-CSSB-GS |l Centre for Structural Systems Biology |x 2 |
| 920 | 1 | _ | |0 I:(DE-H253)CSSB-BNITM-TG-20210520 |k CSSB-BNITM-TG |l CSSB-BNITM-TG |x 3 |
| 980 | _ | _ | |a journal |
| 980 | _ | _ | |a VDB |
| 980 | _ | _ | |a I:(DE-H253)CSSB-BNI-20141216 |
| 980 | _ | _ | |a I:(DE-H253)EMBL-20120731 |
| 980 | _ | _ | |a I:(DE-H253)FS-CSSB-GS-20140815 |
| 980 | _ | _ | |a I:(DE-H253)CSSB-BNITM-TG-20210520 |
| 980 | _ | _ | |a UNRESTRICTED |
| 980 | 1 | _ | |a FullTexts |
| Library | Collection | CLSMajor | CLSMinor | Language | Author |
|---|