guest ::
| Home > Publications database > Biophysical Screening Pipeline for Cryo-EM Grid Preparation of Membrane Proteins > print |
| Home > Publications database > Biophysical Screening Pipeline for Cryo-EM Grid Preparation of Membrane Proteins > print |
| 001 | 604257 | ||
| 005 | 20250724152323.0 | ||
| 024 | 7 | _ | |a 10.3389/fmolb.2022.882288 |2 doi |
| 024 | 7 | _ | |a 10.3204/PUBDB-2024-01055 |2 datacite_doi |
| 024 | 7 | _ | |a altmetric:130120016 |2 altmetric |
| 024 | 7 | _ | |a pmid:35813810 |2 pmid |
| 024 | 7 | _ | |a WOS:000861787900001 |2 WOS |
| 024 | 7 | _ | |a openalex:W4283317779 |2 openalex |
| 037 | _ | _ | |a PUBDB-2024-01055 |
| 041 | _ | _ | |a English |
| 082 | _ | _ | |a 570 |
| 100 | 1 | _ | |a Niebling, Stephan |0 P:(DE-H253)PIP1030856 |b 0 |
| 245 | _ | _ | |a Biophysical Screening Pipeline for Cryo-EM Grid Preparation of Membrane Proteins |
| 260 | _ | _ | |a Lausanne |c 2022 |b Frontiers |
| 336 | 7 | _ | |a article |2 DRIVER |
| 336 | 7 | _ | |a Output Types/Journal article |2 DataCite |
| 336 | 7 | _ | |a Journal Article |b journal |m journal |0 PUB:(DE-HGF)16 |s 1728913467_4051395 |2 PUB:(DE-HGF) |
| 336 | 7 | _ | |a ARTICLE |2 BibTeX |
| 336 | 7 | _ | |a JOURNAL_ARTICLE |2 ORCID |
| 336 | 7 | _ | |a Journal Article |0 0 |2 EndNote |
| 500 | _ | _ | |a Part of this work was performed at the Cryo-EMFacility at CSSB, supported by the UHH and DFG grantnumbers (INST 152/772-1|152/774-1|152/775-1|152/776-1|152/777-1 FUGG) |
| 520 | _ | _ | |a Successful sample preparation is the foundation to any structural biology technique. Membrane proteins are of particular interest as these are important targets for drug design, but also notoriously difficult to work with. For electron cryo-microscopy (cryo-EM), the biophysical characterization of sample purity, homogeneity, and integrity as well as biochemical activity is the prerequisite for the preparation of good quality cryo-EM grids as these factors impact the result of the computational reconstruction. Here, we present a quality control pipeline prior to single particle cryo-EM grid preparation using a combination of biophysical techniques to address the integrity, purity, and oligomeric states of membrane proteins and its complexes to enable reproducible conditions for sample vitrification. Differential scanning fluorimetry following the intrinsic protein fluorescence (nDSF) is used for optimizing buffer and detergent conditions, whereas mass photometry and dynamic light scattering are used to assess aggregation behavior, reconstitution efficiency, and oligomerization. The data collected on nDSF and mass photometry instruments can be analyzed with web servers publicly available at spc.embl-hamburg.de. Case studies to optimize conditions prior to cryo-EM sample preparation of membrane proteins present an example quality assessment to corroborate the usefulness of our pipeline. |
| 536 | _ | _ | |a 899 - ohne Topic (POF4-899) |0 G:(DE-HGF)POF4-899 |c POF4-899 |f POF IV |x 0 |
| 588 | _ | _ | |a Dataset connected to CrossRef, Journals: bib-pubdb1.desy.de |
| 693 | _ | _ | |0 EXP:(DE-MLZ)NOSPEC-20140101 |5 EXP:(DE-MLZ)NOSPEC-20140101 |e No specific instrument |x 0 |
| 700 | 1 | _ | |a Veith, Katharina |0 P:(DE-H253)PIP1025998 |b 1 |
| 700 | 1 | _ | |a Vollmer, Benjamin |0 P:(DE-H253)PIP1085536 |b 2 |
| 700 | 1 | _ | |a Lizarrondo, Javier |0 P:(DE-H253)PIP1086337 |b 3 |
| 700 | 1 | _ | |a Burastero, Osvaldo |0 P:(DE-H253)PIP1091323 |b 4 |
| 700 | 1 | _ | |a Schiller, Janina |0 P:(DE-H253)PIP1096897 |b 5 |
| 700 | 1 | _ | |a Struve Garcia, Angelica |0 P:(DE-H253)PIP1086345 |b 6 |
| 700 | 1 | _ | |a Lewe, Philipp |0 P:(DE-H253)PIP1090867 |b 7 |
| 700 | 1 | _ | |a Seuring, Carolin |0 P:(DE-H253)PIP1020921 |b 8 |
| 700 | 1 | _ | |a Witt, Susanne |0 P:(DE-H253)PIP1085705 |b 9 |
| 700 | 1 | _ | |a García-Alai, María |0 P:(DE-HGF)0 |b 10 |e Corresponding author |
| 773 | _ | _ | |a 10.3389/fmolb.2022.882288 |g Vol. 9, p. 882288 |0 PERI:(DE-600)2814330-9 |p 882288 |t Frontiers in molecular biosciences |v 9 |y 2022 |x 2296-889X |
| 856 | 4 | _ | |y OpenAccess |u https://bib-pubdb1.desy.de/record/604257/files/Biophysical_Screening_Pipeline_for_Cryo-EM_Grid_Pr.pdf |
| 856 | 4 | _ | |y OpenAccess |x pdfa |u https://bib-pubdb1.desy.de/record/604257/files/Biophysical_Screening_Pipeline_for_Cryo-EM_Grid_Pr.pdf?subformat=pdfa |
| 909 | C | O | |o oai:bib-pubdb1.desy.de:604257 |p openaire |p open_access |p VDB |p driver |p dnbdelivery |
| 910 | 1 | _ | |a Centre for Free-Electron Laser Science |0 I:(DE-H253)_CFEL-20120731 |k CFEL |b 0 |6 P:(DE-H253)PIP1030856 |
| 910 | 1 | _ | |a European Molecular Biology Laboratory |0 I:(DE-588b)235011-7 |k EMBL |b 0 |6 P:(DE-H253)PIP1030856 |
| 910 | 1 | _ | |a External Institute |0 I:(DE-HGF)0 |k Extern |b 0 |6 P:(DE-H253)PIP1030856 |
| 910 | 1 | _ | |a External Institute |0 I:(DE-HGF)0 |k Extern |b 1 |6 P:(DE-H253)PIP1025998 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 2 |6 P:(DE-H253)PIP1085536 |
| 910 | 1 | _ | |a European Molecular Biology Laboratory |0 I:(DE-588b)235011-7 |k EMBL |b 3 |6 P:(DE-H253)PIP1086337 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 3 |6 P:(DE-H253)PIP1086337 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 4 |6 P:(DE-H253)PIP1091323 |
| 910 | 1 | _ | |a External Institute |0 I:(DE-HGF)0 |k Extern |b 4 |6 P:(DE-H253)PIP1091323 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 5 |6 P:(DE-H253)PIP1096897 |
| 910 | 1 | _ | |a European Molecular Biology Laboratory |0 I:(DE-588b)235011-7 |k EMBL |b 5 |6 P:(DE-H253)PIP1096897 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 6 |6 P:(DE-H253)PIP1086345 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 7 |6 P:(DE-H253)PIP1090867 |
| 910 | 1 | _ | |a Centre for Free-Electron Laser Science |0 I:(DE-H253)_CFEL-20120731 |k CFEL |b 8 |6 P:(DE-H253)PIP1020921 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 8 |6 P:(DE-H253)PIP1020921 |
| 910 | 1 | _ | |a European XFEL |0 I:(DE-588)1043621512 |k XFEL.EU |b 8 |6 P:(DE-H253)PIP1020921 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 9 |6 P:(DE-H253)PIP1085705 |
| 913 | 1 | _ | |a DE-HGF |b Programmungebundene Forschung |l ohne Programm |1 G:(DE-HGF)POF4-890 |0 G:(DE-HGF)POF4-899 |3 G:(DE-HGF)POF4 |2 G:(DE-HGF)POF4-800 |4 G:(DE-HGF)POF |v ohne Topic |x 0 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0200 |2 StatID |b SCOPUS |d 2024-02-05 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0160 |2 StatID |b Essential Science Indicators |d 2024-02-05 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)1050 |2 StatID |b BIOSIS Previews |d 2024-02-05 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)1190 |2 StatID |b Biological Abstracts |d 2024-02-05 |
| 915 | _ | _ | |a Creative Commons Attribution CC BY 4.0 |0 LIC:(DE-HGF)CCBY4 |2 HGFVOC |
| 915 | _ | _ | |a JCR |0 StatID:(DE-HGF)0100 |2 StatID |b FRONT MOL BIOSCI : 2022 |d 2024-02-05 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0501 |2 StatID |b DOAJ Seal |d 2021-05-11T12:25:52Z |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0500 |2 StatID |b DOAJ |d 2021-05-11T12:25:52Z |
| 915 | _ | _ | |a WoS |0 StatID:(DE-HGF)0113 |2 StatID |b Science Citation Index Expanded |d 2024-02-05 |
| 915 | _ | _ | |a Fees |0 StatID:(DE-HGF)0700 |2 StatID |d 2024-02-05 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0150 |2 StatID |b Web of Science Core Collection |d 2024-02-05 |
| 915 | _ | _ | |a OpenAccess |0 StatID:(DE-HGF)0510 |2 StatID |
| 915 | _ | _ | |a Peer Review |0 StatID:(DE-HGF)0030 |2 StatID |b DOAJ : Anonymous peer review |d 2021-05-11T12:25:52Z |
| 915 | _ | _ | |a Article Processing Charges |0 StatID:(DE-HGF)0561 |2 StatID |d 2024-02-05 |
| 915 | _ | _ | |a IF >= 5 |0 StatID:(DE-HGF)9905 |2 StatID |b FRONT MOL BIOSCI : 2022 |d 2024-02-05 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0300 |2 StatID |b Medline |d 2024-02-05 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0320 |2 StatID |b PubMed Central |d 2024-02-05 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0199 |2 StatID |b Clarivate Analytics Master Journal List |d 2024-02-05 |
| 920 | 1 | _ | |0 I:(DE-H253)CSSB-CF-PP-20210530 |k CSSB-CF-PP |l CSSB - Core Facility - Protein Production |x 0 |
| 920 | 1 | _ | |0 I:(DE-H253)CSSB-LIV-KG-20220525 |k CSSB-LIV-KG |l CSSB - Leibniz-Institut für Experimentelle Virologie (LIV) - Kay Grünewald |x 1 |
| 920 | 1 | _ | |0 I:(DE-H253)CSSB-CF-SPC-20210520 |k CSSB-CF-SPC |l CSSB-CF-SPC |x 2 |
| 920 | 1 | _ | |0 I:(DE-H253)CSSB-CF-CRYO-20210520 |k CSSB-CF-CRYO |l CSSB-CF-CRYO |x 3 |
| 980 | _ | _ | |a journal |
| 980 | _ | _ | |a VDB |
| 980 | _ | _ | |a UNRESTRICTED |
| 980 | _ | _ | |a I:(DE-H253)CSSB-CF-PP-20210530 |
| 980 | _ | _ | |a I:(DE-H253)CSSB-LIV-KG-20220525 |
| 980 | _ | _ | |a I:(DE-H253)CSSB-CF-SPC-20210520 |
| 980 | _ | _ | |a I:(DE-H253)CSSB-CF-CRYO-20210520 |
| 980 | 1 | _ | |a FullTexts |
| Library | Collection | CLSMajor | CLSMinor | Language | Author |
|---|