guest ::
| Home > Publications database > Structure of the mycobacterial ESX-5 type VII secretion system membrane complex by single-particle analysis > print |
| Home > Publications database > Structure of the mycobacterial ESX-5 type VII secretion system membrane complex by single-particle analysis > print |
| 001 | 320299 | ||
| 005 | 20250717103358.0 | ||
| 024 | 7 | _ | |a 10.1038/nmicrobiol.2017.47 |2 doi |
| 024 | 7 | _ | |a WOS:000406000900011 |2 WOS |
| 024 | 7 | _ | |a 10.3204/PUBDB-2017-01665 |2 datacite_doi |
| 024 | 7 | _ | |a altmetric:18699954 |2 altmetric |
| 024 | 7 | _ | |a pmid:28394313 |2 pmid |
| 024 | 7 | _ | |a openalex:W2607240190 |2 openalex |
| 037 | _ | _ | |a PUBDB-2017-01665 |
| 041 | _ | _ | |a English |
| 082 | _ | _ | |a 570 |
| 100 | 1 | _ | |a Beckham, Katherine S. H. |0 0000-0002-4929-6119 |b 0 |
| 245 | _ | _ | |a Structure of the mycobacterial ESX-5 type VII secretion system membrane complex by single-particle analysis |
| 260 | _ | _ | |a London |c 2017 |b Springer Nature |
| 336 | 7 | _ | |a article |2 DRIVER |
| 336 | 7 | _ | |a Output Types/Journal article |2 DataCite |
| 336 | 7 | _ | |a Journal Article |b journal |m journal |0 PUB:(DE-HGF)16 |s 1751634218_2880954 |2 PUB:(DE-HGF) |
| 336 | 7 | _ | |a ARTICLE |2 BibTeX |
| 336 | 7 | _ | |a JOURNAL_ARTICLE |2 ORCID |
| 336 | 7 | _ | |a Journal Article |0 0 |2 EndNote |
| 500 | _ | _ | |a © Macmillan Publishers Limited, part of Springer Nature |
| 520 | _ | _ | |a Mycobacteria are characterized by their impermeable outer membrane, which is rich in mycolic acids$^1$. To transport substrates across this complex cell envelope, mycobacteria rely on type VII (also known as ESX) secretion systems$^2$. In Mycobacterium tuberculosis, these ESX systems are essential for growth and full virulence and therefore represent an attractive target for anti-tuberculosis drugs$^3$. However, the molecular details underlying type VII secretion are largely unknown, due to a lack of structural information. Here, we report the molecular architecture of the ESX-5 membrane complex from Mycobacterium xenopi determined at 13 Å resolution by electron microscopy. The four core proteins of the ESX-5 complex (EccB$_5$, EccC$_5$, EccD$_5$ and EccE$_5$) assemble with equimolar stoichiometry into an oligomeric assembly that displays six-fold symmetry. This membrane-associated complex seems to be embedded exclusively in the inner membrane, which indicates that additional components are required to translocate substrates across the mycobacterial outer membrane. Furthermore, the extended cytosolic domains of the EccC ATPase, which interact with secretion effectors, are highly flexible, suggesting an as yet unseen mode of substrate interaction. Comparison of our results with known structures of other bacterial secretion systems demonstrates that the architecture of type VII secretion system is fundamentally different, suggesting an alternative secretion mechanism. |
| 536 | _ | _ | |a 6215 - Soft Matter, Health and Life Sciences (POF3-621) |0 G:(DE-HGF)POF3-6215 |c POF3-621 |f POF III |x 0 |
| 536 | _ | _ | |a 6G3 - PETRA III (POF3-622) |0 G:(DE-HGF)POF3-6G3 |c POF3-622 |f POF III |x 1 |
| 588 | _ | _ | |a Dataset connected to CrossRef |
| 693 | _ | _ | |a PETRA III |f PETRA Beamline P12 |1 EXP:(DE-H253)PETRAIII-20150101 |0 EXP:(DE-H253)P-P12-20150101 |6 EXP:(DE-H253)P-P12-20150101 |x 0 |
| 700 | 1 | _ | |a Ciccarelli, Luciano |0 P:(DE-H253)PIP1032494 |b 1 |
| 700 | 1 | _ | |a Bunduc, Catalin M. |b 2 |
| 700 | 1 | _ | |a Mertens, Haydyn D. T. |0 P:(DE-H253)PIP1020991 |b 3 |
| 700 | 1 | _ | |a Ummels, Roy |b 4 |
| 700 | 1 | _ | |a Lugmayr, Wolfgang |0 P:(DE-H253)PIP1021411 |b 5 |
| 700 | 1 | _ | |a Mayr, Julia |b 6 |
| 700 | 1 | _ | |a Rettel, Mandy |b 7 |
| 700 | 1 | _ | |a Savitski, Mikhail M. |b 8 |
| 700 | 1 | _ | |a Svergun, Dmitri I. |0 P:(DE-H253)PIP1001422 |b 9 |
| 700 | 1 | _ | |a Bitter, Wilbert |b 10 |
| 700 | 1 | _ | |a Wilmanns, Matthias |0 P:(DE-H253)PIP1001283 |b 11 |
| 700 | 1 | _ | |a Marlovits, Thomas |0 P:(DE-H253)PIP1021412 |b 12 |e Corresponding author |
| 700 | 1 | _ | |a Parret, Annabel H. A. |0 0000-0003-0635-8890 |b 13 |e Corresponding author |
| 700 | 1 | _ | |a Houben, Edith N. G. |0 P:(DE-HGF)0 |b 14 |e Corresponding author |
| 773 | _ | _ | |a 10.1038/nmicrobiol.2017.47 |g Vol. 2, p. 17047 - |0 PERI:(DE-600)2845610-5 |p 17047 |t Nature microbiology |v 2 |y 2017 |x 2058-5276 |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Nature%20Microbiol.%202%20%282017%29%2017047%2C%20Suppl..pdf |y Restricted |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Nature%20Microbiol.%202%20%282017%29%2017047.pdf |y Restricted |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Beckham_2017_forsharing.pdf |y Published on 2017-04-10. Available in OpenAccess from 2017-10-10. |z StatID:(DE-HGF)0510 |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Nature%20Microbiol.%202%20%282017%29%2017047%2C%20Suppl..gif?subformat=icon |x icon |y Restricted |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Nature%20Microbiol.%202%20%282017%29%2017047%2C%20Suppl..jpg?subformat=icon-1440 |x icon-1440 |y Restricted |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Nature%20Microbiol.%202%20%282017%29%2017047%2C%20Suppl..jpg?subformat=icon-180 |x icon-180 |y Restricted |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Nature%20Microbiol.%202%20%282017%29%2017047%2C%20Suppl..jpg?subformat=icon-640 |x icon-640 |y Restricted |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Nature%20Microbiol.%202%20%282017%29%2017047.gif?subformat=icon |x icon |y Restricted |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Nature%20Microbiol.%202%20%282017%29%2017047.jpg?subformat=icon-1440 |x icon-1440 |y Restricted |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Nature%20Microbiol.%202%20%282017%29%2017047.jpg?subformat=icon-180 |x icon-180 |y Restricted |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Nature%20Microbiol.%202%20%282017%29%2017047.jpg?subformat=icon-640 |x icon-640 |y Restricted |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Beckham_2017_forsharing.gif?subformat=icon |x icon |y Published on 2017-04-10. Available in OpenAccess from 2017-10-10. |z StatID:(DE-HGF)0510 |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Beckham_2017_forsharing.jpg?subformat=icon-1440 |x icon-1440 |y Published on 2017-04-10. Available in OpenAccess from 2017-10-10. |z StatID:(DE-HGF)0510 |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Beckham_2017_forsharing.jpg?subformat=icon-180 |x icon-180 |y Published on 2017-04-10. Available in OpenAccess from 2017-10-10. |z StatID:(DE-HGF)0510 |
| 856 | 4 | _ | |u https://bib-pubdb1.desy.de/record/320299/files/Beckham_2017_forsharing.jpg?subformat=icon-640 |x icon-640 |y Published on 2017-04-10. Available in OpenAccess from 2017-10-10. |z StatID:(DE-HGF)0510 |
| 909 | C | O | |o oai:bib-pubdb1.desy.de:320299 |p openaire |p open_access |p VDB |p driver |p dnbdelivery |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 1 |6 P:(DE-H253)PIP1032494 |
| 910 | 1 | _ | |a Externes Institut |0 I:(DE-HGF)0 |k Extern |b 3 |6 P:(DE-H253)PIP1020991 |
| 910 | 1 | _ | |a Externes Institut |0 I:(DE-HGF)0 |k Extern |b 5 |6 P:(DE-H253)PIP1021411 |
| 910 | 1 | _ | |a European Molecular Biology Laboratory |0 I:(DE-588b)235011-7 |k EMBL |b 9 |6 P:(DE-H253)PIP1001422 |
| 910 | 1 | _ | |a Deutsches Elektronen-Synchrotron |0 I:(DE-588b)2008985-5 |k DESY |b 11 |6 P:(DE-H253)PIP1001283 |
| 910 | 1 | _ | |a Centre for Structural Systems Biology |0 I:(DE-H253)_CSSB-20140311 |k CSSB |b 12 |6 P:(DE-H253)PIP1021412 |
| 910 | 1 | _ | |a Deutsches Elektronen-Synchrotron |0 I:(DE-588b)2008985-5 |k DESY |b 12 |6 P:(DE-H253)PIP1021412 |
| 913 | 1 | _ | |a DE-HGF |b Forschungsbereich Materie |l Von Materie zu Materialien und Leben |1 G:(DE-HGF)POF3-620 |0 G:(DE-HGF)POF3-621 |3 G:(DE-HGF)POF3 |2 G:(DE-HGF)POF3-600 |4 G:(DE-HGF)POF |v In-house research on the structure, dynamics and function of matter |9 G:(DE-HGF)POF3-6215 |x 0 |
| 913 | 1 | _ | |a DE-HGF |b Forschungsbereich Materie |l Von Materie zu Materialien und Leben |1 G:(DE-HGF)POF3-620 |0 G:(DE-HGF)POF3-622 |3 G:(DE-HGF)POF3 |2 G:(DE-HGF)POF3-600 |4 G:(DE-HGF)POF |v Facility topic: Research on Matter with Brilliant Light Sources |9 G:(DE-HGF)POF3-6G3 |x 1 |
| 914 | 1 | _ | |y 2017 |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0310 |2 StatID |b NCBI Molecular Biology Database |
| 915 | _ | _ | |a Embargoed OpenAccess |0 StatID:(DE-HGF)0530 |2 StatID |
| 915 | _ | _ | |a DBCoverage |0 StatID:(DE-HGF)0300 |2 StatID |b Medline |
| 920 | 1 | _ | |0 I:(DE-H253)CSSB-UKE-20141216 |k CSSB-UKE |l CSSB-UKE |x 0 |
| 920 | 1 | _ | |0 I:(DE-H253)FS-CSSB-GS-20140815 |k FS-CSSB-GS |l Centre for Structural Systems Biology |x 1 |
| 920 | 1 | _ | |0 I:(DE-H253)EMBL-20120731 |k EMBL |l EMBL |x 2 |
| 920 | 1 | _ | |0 I:(DE-H253)CSSB-UKE-TM-20210520 |k CSSB-UKE-TM |l CSSB-UKE-TM |x 3 |
| 980 | _ | _ | |a journal |
| 980 | _ | _ | |a VDB |
| 980 | _ | _ | |a I:(DE-H253)CSSB-UKE-20141216 |
| 980 | _ | _ | |a I:(DE-H253)FS-CSSB-GS-20140815 |
| 980 | _ | _ | |a I:(DE-H253)EMBL-20120731 |
| 980 | _ | _ | |a I:(DE-H253)CSSB-UKE-TM-20210520 |
| 980 | _ | _ | |a UNRESTRICTED |
| 980 | 1 | _ | |a FullTexts |
| Library | Collection | CLSMajor | CLSMinor | Language | Author |
|---|